C19H23NOSi — CID 141438666
[2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-trimethylsilane (PubChem CID 141438666) has the molecular formula C19H23NOSi and a molecular weight of 309.48 g/mol. Its IUPAC name is [2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-trimethylsilane.
| Compound Name | [2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 141438666 |
| Molecular Formula | C19H23NOSi |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | [2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccccc1C1=N[C@@H](Cc2ccccc2)CO1 |
| InChI | InChI=1S/C19H23NOSi/c1-22(2,3)18-12-8-7-11-17(18)19-20-16(14-21-19)13-15-9-5-4-6-10-15/h4-12,16H,13-14H2,1-3H3/t16-/m0/s1 |
| InChIKey | KKVNZCYWVRZDOD-INIZCTEOSA-N |
| XLogP | 3.62 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|