C25H25ClNOP — CID 155290114
[2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chlorophenyl]-diphenylphosphane (PubChem CID 155290114) has the molecular formula C25H25ClNOP and a molecular weight of 421.91 g/mol. Its IUPAC name is [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chlorophenyl]-diphenylphosphane.
| Compound Name | [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chlorophenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 155290114 |
| Molecular Formula | C25H25ClNOP |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-chlorophenyl]-diphenylphosphane |
| SMILES | CC(C)(C)[C@@H]1COC(c2c(Cl)cccc2P(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C25H25ClNOP/c1-25(2,3)22-17-28-24(27-22)23-20(26)15-10-16-21(23)29(18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-16,22H,17H2,1-3H3/t22-/m0/s1 |
| InChIKey | FNJPDVKPFPKWAR-QFIPXVFZSA-N |
| XLogP | 5.29 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|