C31H38NOP — CID 53380990
[2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-bis(2,4,6-trimethylphenyl)phosphane (PubChem CID 53380990) has the molecular formula C31H38NOP and a molecular weight of 471.63 g/mol. Its IUPAC name is [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-bis(2,4,6-trimethylphenyl)phosphane.
| Compound Name | [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-bis(2,4,6-trimethylphenyl)phosphane |
|---|---|
| PubChem CID | 53380990 |
| Molecular Formula | C31H38NOP |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | [2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-bis(2,4,6-trimethylphenyl)phosphane |
| SMILES | Cc1cc(C)c(P(c2ccccc2C2=N[C@H](C(C)(C)C)CO2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C31H38NOP/c1-19-14-21(3)28(22(4)15-19)34(29-23(5)16-20(2)17-24(29)6)26-13-11-10-12-25(26)30-32-27(18-33-30)31(7,8)9/h10-17,27H,18H2,1-9H3/t27-/m0/s1 |
| InChIKey | KGVNBTWDMSAYCH-MHZLTWQESA-N |
| XLogP | 6.49 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|