C27H20BF6O3+ — CID 159088985
[3,5-bis(trifluoromethyl)phenoxy]boronic acid;[cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene (PubChem CID 159088985) has the molecular formula C27H20BF6O3+ and a molecular weight of 517.25 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenoxy]boronic acid;[cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene.
| Compound Name | [3,5-bis(trifluoromethyl)phenoxy]boronic acid;[cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene |
|---|---|
| PubChem CID | 159088985 |
| Molecular Formula | C27H20BF6O3+ |
| Molecular Weight | 517.25 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenoxy]boronic acid;[cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene |
| SMILES | C1=C[CH+]C(=C(c2ccccc2)c2ccccc2)C=C1.OB(O)Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15.C8H5BF6O3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;10-7(11,12)4-1-5(8(13,14)15)3-6(2-4)18-9(16)17/h1-15H;1-3,16-17H/q+1; |
| InChIKey | KBUVVELAMSUHNV-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.25 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|