C78H83BF6O5P2 — CID 160713573
[3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane;bis(phenacyl-tris(2,4,6-trimethylphenyl)phosphanium) (PubChem CID 160713573) has the molecular formula C78H83BF6O5P2 and a molecular weight of 1287.26 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane;bis(phenacyl-tris(2,4,6-trimethylphenyl)phosphanium).
| Compound Name | [3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane;bis(phenacyl-tris(2,4,6-trimethylphenyl)phosphanium) |
|---|---|
| PubChem CID | 160713573 |
| Molecular Formula | C78H83BF6O5P2 |
| Molecular Weight | 1287.26 g/mol |
| Exact Mass | 1286.57 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane;bis(phenacyl-tris(2,4,6-trimethylphenyl)phosphanium) |
| SMILES | Cc1cc(C)c([P+](CC(=O)c2ccccc2)(c2c(C)cc(C)cc2C)c2c(C)cc(C)cc2C)c(C)c1.Cc1cc(C)c([P+](CC(=O)c2ccccc2)(c2c(C)cc(C)cc2C)c2c(C)cc(C)cc2C)c(C)c1.[O-]B([O-])Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/2C35H40OP.C8H3BF6O3/c2*1-22-15-25(4)33(26(5)16-22)37(21-32(36)31-13-11-10-12-14-31,34-27(6)17-23(2)18-28(34)7)35-29(8)19-24(3)20-30(35)9;10-7(11,12)4-1-5(8(13,14)15)3-6(2-4)18-9(16)17/h2*10-20H,21H2,1-9H3;1-3H/q2*+1;-2 |
| InChIKey | RSEFHDKHRKOPCD-UHFFFAOYSA-N |
| XLogP | 16.09 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1287.26 |
| LogP ≤ 5 | 16.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|