C84H59BF6O5P2 — CID 159506476
[3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane;bis((2-oxo-2-tetracen-5-ylethyl)-triphenylphosphanium) (PubChem CID 159506476) has the molecular formula C84H59BF6O5P2 and a molecular weight of 1335.14 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane;bis((2-oxo-2-tetracen-5-ylethyl)-triphenylphosphanium).
| Compound Name | [3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane;bis((2-oxo-2-tetracen-5-ylethyl)-triphenylphosphanium) |
|---|---|
| PubChem CID | 159506476 |
| Molecular Formula | C84H59BF6O5P2 |
| Molecular Weight | 1335.14 g/mol |
| Exact Mass | 1334.38 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane;bis((2-oxo-2-tetracen-5-ylethyl)-triphenylphosphanium) |
| SMILES | O=C(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1c2ccccc2cc2cc3ccccc3cc12.O=C(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1c2ccccc2cc2cc3ccccc3cc12.[O-]B([O-])Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/2C38H28OP.C8H3BF6O3/c2*39-37(38-35-23-13-12-16-30(35)25-31-24-28-14-10-11-15-29(28)26-36(31)38)27-40(32-17-4-1-5-18-32,33-19-6-2-7-20-33)34-21-8-3-9-22-34;10-7(11,12)4-1-5(8(13,14)15)3-6(2-4)18-9(16)17/h2*1-26H,27H2;1-3H/q2*+1;-2 |
| InChIKey | MABAQVUMMWXYNS-UHFFFAOYSA-N |
| XLogP | 17.45 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 98 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1335.14 |
| LogP ≤ 5 | 17.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|