C72H71BF6O5P2 — CID 139734758
[3,5-bis(trifluoromethyl)phenyl] bis[tris(2,5-dimethylphenyl)-phenacyl-λ5-phosphanyl] borate (PubChem CID 139734758) has the molecular formula C72H71BF6O5P2 and a molecular weight of 1203.10 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] bis[tris(2,5-dimethylphenyl)-phenacyl-λ5-phosphanyl] borate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] bis[tris(2,5-dimethylphenyl)-phenacyl-λ5-phosphanyl] borate |
|---|---|
| PubChem CID | 139734758 |
| Molecular Formula | C72H71BF6O5P2 |
| Molecular Weight | 1203.10 g/mol |
| Exact Mass | 1202.48 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] bis[tris(2,5-dimethylphenyl)-phenacyl-λ5-phosphanyl] borate |
| SMILES | Cc1ccc(C)c(P(CC(=O)c2ccccc2)(OB(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)OP(CC(=O)c2ccccc2)(c2cc(C)ccc2C)(c2cc(C)ccc2C)c2cc(C)ccc2C)(c2cc(C)ccc2C)c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C72H71BF6O5P2/c1-46-23-29-52(7)65(35-46)85(66-36-47(2)24-30-53(66)8,67-37-48(3)25-31-54(67)9,44-63(80)58-19-15-13-16-20-58)83-73(82-62-42-60(71(74,75)76)41-61(43-62)72(77,78)79)84-86(68-38-49(4)26-32-55(68)10,69-39-50(5)27-33-56(69)11,70-40-51(6)28-34-57(70)12)45-64(81)59-21-17-14-18-22-59/h13-43H,44-45H2,1-12H3 |
| InChIKey | SIGLMZAMVJEPHC-UHFFFAOYSA-N |
| XLogP | 16.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1203.10 |
| LogP ≤ 5 | 16.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|