C62H51BF6O7P2S2 — CID 139734354
[3,5-bis(trifluoromethyl)phenyl] bis[[2-(3-methylsulfinylphenyl)-2-oxoethyl]-triphenyl-λ5-phosphanyl] borate (PubChem CID 139734354) has the molecular formula C62H51BF6O7P2S2 and a molecular weight of 1158.96 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] bis[[2-(3-methylsulfinylphenyl)-2-oxoethyl]-triphenyl-λ5-phosphanyl] borate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] bis[[2-(3-methylsulfinylphenyl)-2-oxoethyl]-triphenyl-λ5-phosphanyl] borate |
|---|---|
| PubChem CID | 139734354 |
| Molecular Formula | C62H51BF6O7P2S2 |
| Molecular Weight | 1158.96 g/mol |
| Exact Mass | 1158.25 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] bis[[2-(3-methylsulfinylphenyl)-2-oxoethyl]-triphenyl-λ5-phosphanyl] borate |
| SMILES | CS(=O)c1cccc(C(=O)CP(OB(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)OP(CC(=O)c2cccc(S(C)=O)c2)(c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C62H51BF6O7P2S2/c1-79(72)57-37-21-23-46(39-57)59(70)44-77(51-25-9-3-10-26-51,52-27-11-4-12-28-52,53-29-13-5-14-30-53)75-63(74-50-42-48(61(64,65)66)41-49(43-50)62(67,68)69)76-78(54-31-15-6-16-32-54,55-33-17-7-18-34-55,56-35-19-8-20-36-56)45-60(71)47-24-22-38-58(40-47)80(2)73/h3-43H,44-45H2,1-2H3 |
| InChIKey | QJPXUQWIOYKGMJ-UHFFFAOYSA-N |
| XLogP | 12.25 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1158.96 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|