C72H55BF6O5P2 — CID 139734737
bis[(2-benzoylphenyl)methyl-triphenyl-λ5-phosphanyl] [3,5-bis(trifluoromethyl)phenyl] borate (PubChem CID 139734737) has the molecular formula C72H55BF6O5P2 and a molecular weight of 1186.98 g/mol. Its IUPAC name is bis[(2-benzoylphenyl)methyl-triphenyl-λ5-phosphanyl] [3,5-bis(trifluoromethyl)phenyl] borate.
| Compound Name | bis[(2-benzoylphenyl)methyl-triphenyl-λ5-phosphanyl] [3,5-bis(trifluoromethyl)phenyl] borate |
|---|---|
| PubChem CID | 139734737 |
| Molecular Formula | C72H55BF6O5P2 |
| Molecular Weight | 1186.98 g/mol |
| Exact Mass | 1186.35 |
| IUPAC Name | bis[(2-benzoylphenyl)methyl-triphenyl-λ5-phosphanyl] [3,5-bis(trifluoromethyl)phenyl] borate |
| SMILES | O=C(c1ccccc1)c1ccccc1CP(OB(Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1)OP(Cc1ccccc1C(=O)c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C72H55BF6O5P2/c74-71(75,76)58-49-59(72(77,78)79)51-60(50-58)82-73(83-85(61-35-13-3-14-36-61,62-37-15-4-16-38-62,63-39-17-5-18-40-63)52-56-33-25-27-47-67(56)69(80)54-29-9-1-10-30-54)84-86(64-41-19-6-20-42-64,65-43-21-7-22-44-65,66-45-23-8-24-46-66)53-57-34-26-28-48-68(57)70(81)55-31-11-2-12-32-55/h1-51H,52-53H2 |
| InChIKey | FKUZFXKJUMZZII-UHFFFAOYSA-N |
| XLogP | 15.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1186.98 |
| LogP ≤ 5 | 15.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|