C58H37BF16O3P2 — CID 139734280
[3,5-bis(trifluoromethyl)phenyl] bis[(2,3,4,5,6-pentafluorophenyl)methyl-triphenyl-λ5-phosphanyl] borate (PubChem CID 139734280) has the molecular formula C58H37BF16O3P2 and a molecular weight of 1158.66 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] bis[(2,3,4,5,6-pentafluorophenyl)methyl-triphenyl-λ5-phosphanyl] borate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] bis[(2,3,4,5,6-pentafluorophenyl)methyl-triphenyl-λ5-phosphanyl] borate |
|---|---|
| PubChem CID | 139734280 |
| Molecular Formula | C58H37BF16O3P2 |
| Molecular Weight | 1158.66 g/mol |
| Exact Mass | 1158.21 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] bis[(2,3,4,5,6-pentafluorophenyl)methyl-triphenyl-λ5-phosphanyl] borate |
| SMILES | Fc1c(F)c(F)c(CP(OB(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)OP(Cc2c(F)c(F)c(F)c(F)c2F)(c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)(c2ccccc2)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C58H37BF16O3P2/c60-47-45(48(61)52(65)55(68)51(47)64)34-79(39-19-7-1-8-20-39,40-21-9-2-10-22-40,41-23-11-3-12-24-41)77-59(76-38-32-36(57(70,71)72)31-37(33-38)58(73,74)75)78-80(42-25-13-4-14-26-42,43-27-15-5-16-28-43,44-29-17-6-18-30-44)35-46-49(62)53(66)56(69)54(67)50(46)63/h1-33H,34-35H2 |
| InChIKey | LTROIFPULXHCRA-UHFFFAOYSA-N |
| XLogP | 14.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1158.66 |
| LogP ≤ 5 | 14.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|