C64H47BF6O5P2 — CID 139734612
[3,5-bis(trifluoromethyl)phenyl] bis[naphthalen-1-yloxy(triphenyl)-λ5-phosphanyl] borate (PubChem CID 139734612) has the molecular formula C64H47BF6O5P2 and a molecular weight of 1082.82 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] bis[naphthalen-1-yloxy(triphenyl)-λ5-phosphanyl] borate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] bis[naphthalen-1-yloxy(triphenyl)-λ5-phosphanyl] borate |
|---|---|
| PubChem CID | 139734612 |
| Molecular Formula | C64H47BF6O5P2 |
| Molecular Weight | 1082.82 g/mol |
| Exact Mass | 1082.29 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] bis[naphthalen-1-yloxy(triphenyl)-λ5-phosphanyl] borate |
| SMILES | FC(F)(F)c1cc(OB(OP(Oc2cccc3ccccc23)(c2ccccc2)(c2ccccc2)c2ccccc2)OP(Oc2cccc3ccccc23)(c2ccccc2)(c2ccccc2)c2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C64H47BF6O5P2/c66-63(67,68)50-45-51(64(69,70)71)47-52(46-50)72-65(75-77(53-29-7-1-8-30-53,54-31-9-2-10-32-54,55-33-11-3-12-34-55)73-61-43-23-27-48-25-19-21-41-59(48)61)76-78(56-35-13-4-14-36-56,57-37-15-5-16-38-57,58-39-17-6-18-40-58)74-62-44-24-28-49-26-20-22-42-60(49)62/h1-47H |
| InChIKey | RXKSBNDXCUBEMT-UHFFFAOYSA-N |
| XLogP | 15.31 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1082.82 |
| LogP ≤ 5 | 15.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|