C66H41BF6N6O5P2 — CID 139734312
[3,5-bis(trifluoromethyl)phenyl] bis[tris(4-cyanophenyl)-phenacyl-λ5-phosphanyl] borate (PubChem CID 139734312) has the molecular formula C66H41BF6N6O5P2 and a molecular weight of 1184.84 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] bis[tris(4-cyanophenyl)-phenacyl-λ5-phosphanyl] borate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] bis[tris(4-cyanophenyl)-phenacyl-λ5-phosphanyl] borate |
|---|---|
| PubChem CID | 139734312 |
| Molecular Formula | C66H41BF6N6O5P2 |
| Molecular Weight | 1184.84 g/mol |
| Exact Mass | 1184.26 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] bis[tris(4-cyanophenyl)-phenacyl-λ5-phosphanyl] borate |
| SMILES | N#Cc1ccc(P(CC(=O)c2ccccc2)(OB(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)OP(CC(=O)c2ccccc2)(c2ccc(C#N)cc2)(c2ccc(C#N)cc2)c2ccc(C#N)cc2)(c2ccc(C#N)cc2)c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C66H41BF6N6O5P2/c68-65(69,70)54-35-55(66(71,72)73)37-56(36-54)82-67(83-85(57-23-11-46(38-74)12-24-57,58-25-13-47(39-75)14-26-58,59-27-15-48(40-76)16-28-59)44-63(80)52-7-3-1-4-8-52)84-86(60-29-17-49(41-77)18-30-60,61-31-19-50(42-78)20-32-61,62-33-21-51(43-79)22-34-62)45-64(81)53-9-5-2-6-10-53/h1-37H,44-45H2 |
| InChIKey | QDIRSPNZHNYBBC-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 204.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 86 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1184.84 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|