C66H59BF6O5P2 — CID 139734545
[3,5-bis(trifluoromethyl)phenyl] bis[[2-oxo-2-(4-propylphenyl)ethyl]-triphenyl-λ5-phosphanyl] borate (PubChem CID 139734545) has the molecular formula C66H59BF6O5P2 and a molecular weight of 1118.94 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] bis[[2-oxo-2-(4-propylphenyl)ethyl]-triphenyl-λ5-phosphanyl] borate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] bis[[2-oxo-2-(4-propylphenyl)ethyl]-triphenyl-λ5-phosphanyl] borate |
|---|---|
| PubChem CID | 139734545 |
| Molecular Formula | C66H59BF6O5P2 |
| Molecular Weight | 1118.94 g/mol |
| Exact Mass | 1118.38 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] bis[[2-oxo-2-(4-propylphenyl)ethyl]-triphenyl-λ5-phosphanyl] borate |
| SMILES | CCCc1ccc(C(=O)CP(OB(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)OP(CC(=O)c2ccc(CCC)cc2)(c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C66H59BF6O5P2/c1-3-23-50-37-41-52(42-38-50)63(74)48-79(57-25-11-5-12-26-57,58-27-13-6-14-28-58,59-29-15-7-16-30-59)77-67(76-56-46-54(65(68,69)70)45-55(47-56)66(71,72)73)78-80(60-31-17-8-18-32-60,61-33-19-9-20-34-61,62-35-21-10-22-36-62)49-64(75)53-43-39-51(24-4-2)40-44-53/h5-22,25-47H,3-4,23-24,48-49H2,1-2H3 |
| InChIKey | IKAMRLLPNPCFJG-UHFFFAOYSA-N |
| XLogP | 14.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1118.94 |
| LogP ≤ 5 | 14.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|