C64H59BF6O3P2 — CID 139734356
[3,5-bis(trifluoromethyl)phenyl] bis[triphenyl-[(4-propylphenyl)methyl]-λ5-phosphanyl] borate (PubChem CID 139734356) has the molecular formula C64H59BF6O3P2 and a molecular weight of 1062.92 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] bis[triphenyl-[(4-propylphenyl)methyl]-λ5-phosphanyl] borate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] bis[triphenyl-[(4-propylphenyl)methyl]-λ5-phosphanyl] borate |
|---|---|
| PubChem CID | 139734356 |
| Molecular Formula | C64H59BF6O3P2 |
| Molecular Weight | 1062.92 g/mol |
| Exact Mass | 1062.39 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] bis[triphenyl-[(4-propylphenyl)methyl]-λ5-phosphanyl] borate |
| SMILES | CCCc1ccc(CP(OB(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)OP(Cc2ccc(CCC)cc2)(c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C64H59BF6O3P2/c1-3-23-50-37-41-52(42-38-50)48-75(57-25-11-5-12-26-57,58-27-13-6-14-28-58,59-29-15-7-16-30-59)73-65(72-56-46-54(63(66,67)68)45-55(47-56)64(69,70)71)74-76(60-31-17-8-18-32-60,61-33-19-9-20-34-61,62-35-21-10-22-36-62)49-53-43-39-51(24-4-2)40-44-53/h5-22,25-47H,3-4,23-24,48-49H2,1-2H3 |
| InChIKey | VPGUDPJQOHVDBU-UHFFFAOYSA-N |
| XLogP | 15.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1062.92 |
| LogP ≤ 5 | 15.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|