C62H51BF6O5P2 — CID 139734350
bis[(3-acetylphenyl)methyl-triphenyl-λ5-phosphanyl] [3,5-bis(trifluoromethyl)phenyl] borate (PubChem CID 139734350) has the molecular formula C62H51BF6O5P2 and a molecular weight of 1062.83 g/mol. Its IUPAC name is bis[(3-acetylphenyl)methyl-triphenyl-λ5-phosphanyl] [3,5-bis(trifluoromethyl)phenyl] borate.
| Compound Name | bis[(3-acetylphenyl)methyl-triphenyl-λ5-phosphanyl] [3,5-bis(trifluoromethyl)phenyl] borate |
|---|---|
| PubChem CID | 139734350 |
| Molecular Formula | C62H51BF6O5P2 |
| Molecular Weight | 1062.83 g/mol |
| Exact Mass | 1062.32 |
| IUPAC Name | bis[(3-acetylphenyl)methyl-triphenyl-λ5-phosphanyl] [3,5-bis(trifluoromethyl)phenyl] borate |
| SMILES | CC(=O)c1cccc(CP(OB(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)OP(Cc2cccc(C(C)=O)c2)(c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C62H51BF6O5P2/c1-46(70)50-25-21-23-48(39-50)44-75(55-27-9-3-10-28-55,56-29-11-4-12-30-56,57-31-13-5-14-32-57)73-63(72-54-42-52(61(64,65)66)41-53(43-54)62(67,68)69)74-76(58-33-15-6-16-34-58,59-35-17-7-18-36-59,60-37-19-8-20-38-60)45-49-24-22-26-51(40-49)47(2)71/h3-43H,44-45H2,1-2H3 |
| InChIKey | LFXIWMKWVFBJLR-UHFFFAOYSA-N |
| XLogP | 13.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1062.83 |
| LogP ≤ 5 | 13.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|