C60H45BF6N2O9P2 — CID 139734424
[3,5-bis(trifluoromethyl)phenyl] bis[[2-(2-nitrophenyl)-2-oxoethyl]-triphenyl-λ5-phosphanyl] borate (PubChem CID 139734424) has the molecular formula C60H45BF6N2O9P2 and a molecular weight of 1124.77 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] bis[[2-(2-nitrophenyl)-2-oxoethyl]-triphenyl-λ5-phosphanyl] borate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] bis[[2-(2-nitrophenyl)-2-oxoethyl]-triphenyl-λ5-phosphanyl] borate |
|---|---|
| PubChem CID | 139734424 |
| Molecular Formula | C60H45BF6N2O9P2 |
| Molecular Weight | 1124.77 g/mol |
| Exact Mass | 1124.26 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] bis[[2-(2-nitrophenyl)-2-oxoethyl]-triphenyl-λ5-phosphanyl] borate |
| SMILES | O=C(CP(OB(Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1)OP(CC(=O)c1ccccc1[N+](=O)[O-])(c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C60H45BF6N2O9P2/c62-59(63,64)44-39-45(60(65,66)67)41-46(40-44)76-61(77-79(47-23-7-1-8-24-47,48-25-9-2-10-26-48,49-27-11-3-12-28-49)42-57(70)53-35-19-21-37-55(53)68(72)73)78-80(50-29-13-4-14-30-50,51-31-15-5-16-32-51,52-33-17-6-18-34-52)43-58(71)54-36-20-22-38-56(54)69(74)75/h1-41H,42-43H2 |
| InChIKey | VSZLKQPKTQTVBY-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 148.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1124.77 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|