C74H55BF6O7P2 — CID 157251041
bis([2-(2-benzoylphenyl)-2-oxoethyl]-triphenylphosphanium);[3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane (PubChem CID 157251041) has the molecular formula C74H55BF6O7P2 and a molecular weight of 1243.00 g/mol. Its IUPAC name is bis([2-(2-benzoylphenyl)-2-oxoethyl]-triphenylphosphanium);[3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane.
| Compound Name | bis([2-(2-benzoylphenyl)-2-oxoethyl]-triphenylphosphanium);[3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane |
|---|---|
| PubChem CID | 157251041 |
| Molecular Formula | C74H55BF6O7P2 |
| Molecular Weight | 1243.00 g/mol |
| Exact Mass | 1242.34 |
| IUPAC Name | bis([2-(2-benzoylphenyl)-2-oxoethyl]-triphenylphosphanium);[3,5-bis(trifluoromethyl)phenoxy]-dioxidoborane |
| SMILES | O=C(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1C(=O)c1ccccc1.O=C(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1C(=O)c1ccccc1.[O-]B([O-])Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/2C33H26O2P.C8H3BF6O3/c2*34-32(30-23-13-14-24-31(30)33(35)26-15-5-1-6-16-26)25-36(27-17-7-2-8-18-27,28-19-9-3-10-20-28)29-21-11-4-12-22-29;10-7(11,12)4-1-5(8(13,14)15)3-6(2-4)18-9(16)17/h2*1-24H,25H2;1-3H/q2*+1;-2 |
| InChIKey | AWIRVEUEVFCZOU-UHFFFAOYSA-N |
| XLogP | 13.00 |
| TPSA | 123.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1243.00 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|