C15H7BrF6O — CID 172878103
[3,5-bis(trifluoromethyl)phenyl]-(2-bromophenyl)methanone (PubChem CID 172878103) has the molecular formula C15H7BrF6O and a molecular weight of 397.11 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-(2-bromophenyl)methanone.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-(2-bromophenyl)methanone |
|---|---|
| PubChem CID | 172878103 |
| Molecular Formula | C15H7BrF6O |
| Molecular Weight | 397.11 g/mol |
| Exact Mass | 395.96 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-(2-bromophenyl)methanone |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1Br |
| InChI | InChI=1S/C15H7BrF6O/c16-12-4-2-1-3-11(12)13(23)8-5-9(14(17,18)19)7-10(6-8)15(20,21)22/h1-7H |
| InChIKey | FRNFQYRPYZVMLB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.11 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |