C28H19F6OP — CID 140549408
[3,5-bis(trifluoromethyl)phenyl]-[2-[methylidene(diphenyl)-λ5-phosphanyl]phenyl]methanone (PubChem CID 140549408) has the molecular formula C28H19F6OP and a molecular weight of 516.42 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-[2-[methylidene(diphenyl)-λ5-phosphanyl]phenyl]methanone.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-[2-[methylidene(diphenyl)-λ5-phosphanyl]phenyl]methanone |
|---|---|
| PubChem CID | 140549408 |
| Molecular Formula | C28H19F6OP |
| Molecular Weight | 516.42 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-[2-[methylidene(diphenyl)-λ5-phosphanyl]phenyl]methanone |
| SMILES | C=P(c1ccccc1)(c1ccccc1)c1ccccc1C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H19F6OP/c1-36(22-10-4-2-5-11-22,23-12-6-3-7-13-23)25-15-9-8-14-24(25)26(35)19-16-20(27(29,30)31)18-21(17-19)28(32,33)34/h2-18H,1H2 |
| InChIKey | AXDMWZAUFVTCQP-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.42 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|