C23H15F6O2P — CID 172831491
2,2,2-trifluoro-1-[3-[methylidene(diphenyl)-λ5-phosphanyl]-2-(2,2,2-trifluoroacetyl)phenyl]ethanone (PubChem CID 172831491) has the molecular formula C23H15F6O2P and a molecular weight of 468.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[3-[methylidene(diphenyl)-λ5-phosphanyl]-2-(2,2,2-trifluoroacetyl)phenyl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[3-[methylidene(diphenyl)-λ5-phosphanyl]-2-(2,2,2-trifluoroacetyl)phenyl]ethanone |
|---|---|
| PubChem CID | 172831491 |
| Molecular Formula | C23H15F6O2P |
| Molecular Weight | 468.33 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 2,2,2-trifluoro-1-[3-[methylidene(diphenyl)-λ5-phosphanyl]-2-(2,2,2-trifluoroacetyl)phenyl]ethanone |
| SMILES | C=P(c1ccccc1)(c1ccccc1)c1cccc(C(=O)C(F)(F)F)c1C(=O)C(F)(F)F |
| InChI | InChI=1S/C23H15F6O2P/c1-32(15-9-4-2-5-10-15,16-11-6-3-7-12-16)18-14-8-13-17(20(30)22(24,25)26)19(18)21(31)23(27,28)29/h2-14H,1H2 |
| InChIKey | VOOCDNBVFYYBTE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.33 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|