C14H17F3O — CID 144759279
ethane;ethene;1-(2-ethenylphenyl)-2,2,2-trifluoroethanone (PubChem CID 144759279) has the molecular formula C14H17F3O and a molecular weight of 258.28 g/mol. Its IUPAC name is ethane;ethene;1-(2-ethenylphenyl)-2,2,2-trifluoroethanone.
| Compound Name | ethane;ethene;1-(2-ethenylphenyl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 144759279 |
| Molecular Formula | C14H17F3O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | ethane;ethene;1-(2-ethenylphenyl)-2,2,2-trifluoroethanone |
| SMILES | C=C.C=Cc1ccccc1C(=O)C(F)(F)F.CC |
| InChI | InChI=1S/C10H7F3O.C2H6.C2H4/c1-2-7-5-3-4-6-8(7)9(14)10(11,12)13;2*1-2/h2-6H,1H2;1-2H3;1-2H2 |
| InChIKey | BHIOVKKRWBMAHM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|