C16H14F3NO2 — CID 174618366
1-[2-[benzyl(methoxy)amino]phenyl]-2,2,2-trifluoroethanone (PubChem CID 174618366) has the molecular formula C16H14F3NO2 and a molecular weight of 309.29 g/mol. Its IUPAC name is 1-[2-[benzyl(methoxy)amino]phenyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[2-[benzyl(methoxy)amino]phenyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 174618366 |
| Molecular Formula | C16H14F3NO2 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 1-[2-[benzyl(methoxy)amino]phenyl]-2,2,2-trifluoroethanone |
| SMILES | CON(Cc1ccccc1)c1ccccc1C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H14F3NO2/c1-22-20(11-12-7-3-2-4-8-12)14-10-6-5-9-13(14)15(21)16(17,18)19/h2-10H,11H2,1H3 |
| InChIKey | AUVBBEJVFBEIDX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|