C15H18F6N2O2 — CID 134099282
N-[2-[benzyl(2-methoxyethyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]acetamide (PubChem CID 134099282) has the molecular formula C15H18F6N2O2 and a molecular weight of 372.31 g/mol. Its IUPAC name is N-[2-[benzyl(2-methoxyethyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]acetamide.
| Compound Name | N-[2-[benzyl(2-methoxyethyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]acetamide |
|---|---|
| PubChem CID | 134099282 |
| Molecular Formula | C15H18F6N2O2 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[2-[benzyl(2-methoxyethyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]acetamide |
| SMILES | COCCN(Cc1ccccc1)C(NC(C)=O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H18F6N2O2/c1-11(24)22-13(14(16,17)18,15(19,20)21)23(8-9-25-2)10-12-6-4-3-5-7-12/h3-7H,8-10H2,1-2H3,(H,22,24) |
| InChIKey | BNTRDLVSYNZXES-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|