C9H5F6NO — CID 98461840
1-[2-amino-3-(trifluoromethyl)phenyl]-2,2,2-trifluoroethanone (PubChem CID 98461840) has the molecular formula C9H5F6NO and a molecular weight of 257.13 g/mol. Its IUPAC name is 1-[2-amino-3-(trifluoromethyl)phenyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[2-amino-3-(trifluoromethyl)phenyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 98461840 |
| Molecular Formula | C9H5F6NO |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 1-[2-amino-3-(trifluoromethyl)phenyl]-2,2,2-trifluoroethanone |
| SMILES | Nc1c(C(=O)C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C9H5F6NO/c10-8(11,12)5-3-1-2-4(6(5)16)7(17)9(13,14)15/h1-3H,16H2 |
| InChIKey | PRLNOFWIIWOPDH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|