About 3-[2-amino-3-(trifluoromethyl)phenyl]-2-(dimethyl-λ4-sulfanylidene)-3-oxopropanenitrile
3-[2-amino-3-(trifluoromethyl)phenyl]-2-(dimethyl-λ4-sulfanylidene)-3-oxopropanenitrile (PubChem CID 102501174) has the molecular formula C12H11F3N2OS
and a molecular weight of 288.29 g/mol. Its IUPAC name is 3-[2-amino-3-(trifluoromethyl)phenyl]-2-(dimethyl-λ4-sulfanylidene)-3-oxopropanenitrile.
Molecular Properties
| Compound Name | 3-[2-amino-3-(trifluoromethyl)phenyl]-2-(dimethyl-λ4-sulfanylidene)-3-oxopropanenitrile |
| PubChem CID | 102501174 |
| Molecular Formula | C12H11F3N2OS |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 3-[2-amino-3-(trifluoromethyl)phenyl]-2-(dimethyl-λ4-sulfanylidene)-3-oxopropanenitrile |
| SMILES | CS(C)=C(C#N)C(=O)c1cccc(C(F)(F)F)c1N |
| InChI | InChI=1S/C12H11F3N2OS/c1-19(2)9(6-16)11(18)7-4-3-5-8(10(7)17)12(13,14)15/h3-5H,17H2,1-2H3 |
| InChIKey | YPQGOFUEOYDQNZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-amino-3-(trifluoromethyl)phenyl]-2-(dimethyl-λ4-sulfanylidene)-3-oxopropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-amino-3-(trifluoromethyl)phenyl]-2-(dimethyl-λ4-sulfanylidene)-3-oxopropanenitrile?
The IUPAC name of 3-[2-amino-3-(trifluoromethyl)phenyl]-2-(dimethyl-λ4-sulfanylidene)-3-oxopropanenitrile (CID 102501174) is 3-[2-amino-3-(trifluoromethyl)phenyl]-2-(dimethyl-λ4-sulfanylidene)-3-oxopropanenitrile.
What is the SMILES notation for 3-[2-amino-3-(trifluoromethyl)phenyl]-2-(dimethyl-λ4-sulfanylidene)-3-oxopropanenitrile?
The canonical SMILES for 3-[2-amino-3-(trifluoromethyl)phenyl]-2-(dimethyl-λ4-sulfanylidene)-3-oxopropanenitrile is CS(C)=C(C#N)C(=O)c1cccc(C(F)(F)F)c1N.
What is the InChIKey of 3-[2-amino-3-(trifluoromethyl)phenyl]-2-(dimethyl-λ4-sulfanylidene)-3-oxopropanenitrile?
The InChIKey is YPQGOFUEOYDQNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3N2OS/c1-19(2)9(6-16)11(18)7-4-3-5-8(10(7)17)12(13,14)15/h3-5H,17H2,1-2H3.
What are the key properties of 3-[2-amino-3-(trifluoromethyl)phenyl]-2-(dimethyl-λ4-sulfanylidene)-3-oxopropanenitrile?
3-[2-amino-3-(trifluoromethyl)phenyl]-2-(dimethyl-λ4-sulfanylidene)-3-oxopropanenitrile has a molecular weight of 288.29 g/mol, XLogP of 2.69, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-amino-3-(trifluoromethyl)phenyl]-2-(dimethyl-λ4-sulfanylidene)-3-oxopropanenitrile is sourced from PubChem (CID 102501174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).