C12H10F3N3O2S — CID 106383418
2-amino-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]-3-(trifluoromethyl)benzamide (PubChem CID 106383418) has the molecular formula C12H10F3N3O2S and a molecular weight of 317.29 g/mol. Its IUPAC name is 2-amino-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 2-amino-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 106383418 |
| Molecular Formula | C12H10F3N3O2S |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-amino-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]-3-(trifluoromethyl)benzamide |
| SMILES | Nc1c(C(=O)NCc2csc(=O)[nH]2)cccc1C(F)(F)F |
| InChI | InChI=1S/C12H10F3N3O2S/c13-12(14,15)8-3-1-2-7(9(8)16)10(19)17-4-6-5-21-11(20)18-6/h1-3,5H,4,16H2,(H,17,19)(H,18,20) |
| InChIKey | ULXRMQUDWJWOFC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|