C11H10BrN3O2S — CID 106382415
2-amino-5-bromo-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide (PubChem CID 106382415) has the molecular formula C11H10BrN3O2S and a molecular weight of 328.19 g/mol. Its IUPAC name is 2-amino-5-bromo-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide.
| Compound Name | 2-amino-5-bromo-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 106382415 |
| Molecular Formula | C11H10BrN3O2S |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 2-amino-5-bromo-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide |
| SMILES | Nc1ccc(Br)cc1C(=O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C11H10BrN3O2S/c12-6-1-2-9(13)8(3-6)10(16)14-4-7-5-18-11(17)15-7/h1-3,5H,4,13H2,(H,14,16)(H,15,17) |
| InChIKey | RVLJDWLWBGTHBQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|