C13H15N3O3S — CID 106379162
3-amino-2-ethoxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide (PubChem CID 106379162) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 3-amino-2-ethoxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide.
| Compound Name | 3-amino-2-ethoxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 106379162 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 3-amino-2-ethoxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide |
| SMILES | CCOc1c(N)cccc1C(=O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C13H15N3O3S/c1-2-19-11-9(4-3-5-10(11)14)12(17)15-6-8-7-20-13(18)16-8/h3-5,7H,2,6,14H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | BUBZTKPXARQLDM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|