C12H13N3O3S — CID 106379163
2-(2-aminophenoxy)-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]acetamide (PubChem CID 106379163) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-(2-aminophenoxy)-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]acetamide.
| Compound Name | 2-(2-aminophenoxy)-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 106379163 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-(2-aminophenoxy)-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]acetamide |
| SMILES | Nc1ccccc1OCC(=O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C12H13N3O3S/c13-9-3-1-2-4-10(9)18-6-11(16)14-5-8-7-19-12(17)15-8/h1-4,7H,5-6,13H2,(H,14,16)(H,15,17) |
| InChIKey | GEGTUSIOXAVVMP-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|