C10H8FN3O2S — CID 107358887
2-fluoro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]pyridine-3-carboxamide (PubChem CID 107358887) has the molecular formula C10H8FN3O2S and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-fluoro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]pyridine-3-carboxamide.
| Compound Name | 2-fluoro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 107358887 |
| Molecular Formula | C10H8FN3O2S |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 2-fluoro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1csc(=O)[nH]1)c1cccnc1F |
| InChI | InChI=1S/C10H8FN3O2S/c11-8-7(2-1-3-12-8)9(15)13-4-6-5-17-10(16)14-6/h1-3,5H,4H2,(H,13,15)(H,14,16) |
| InChIKey | SRJGPQWOCGRNOL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|