C11H12N4O2S — CID 106383250
3-amino-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzamide (PubChem CID 106383250) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is 3-amino-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzamide.
| Compound Name | 3-amino-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 106383250 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 3-amino-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzamide |
| SMILES | NC(=O)c1cccc(N)c1NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C11H12N4O2S/c12-8-3-1-2-7(10(13)16)9(8)14-4-6-5-18-11(17)15-6/h1-3,5,14H,4,12H2,(H2,13,16)(H,15,17) |
| InChIKey | MXEZKAOHOSPDTB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|