C11H10BrN3OS2 — CID 114181500
4-bromo-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzenecarbothioamide (PubChem CID 114181500) has the molecular formula C11H10BrN3OS2 and a molecular weight of 344.26 g/mol. Its IUPAC name is 4-bromo-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzenecarbothioamide.
| Compound Name | 4-bromo-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 114181500 |
| Molecular Formula | C11H10BrN3OS2 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 342.94 |
| IUPAC Name | 4-bromo-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Br)cc1NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C11H10BrN3OS2/c12-6-1-2-8(10(13)17)9(3-6)14-4-7-5-18-11(16)15-7/h1-3,5,14H,4H2,(H2,13,17)(H,15,16) |
| InChIKey | CETCXAHQRMIQGM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|