C10H14BrN3O2S2 — CID 106339245
4-bromo-2-[2-(methylsulfamoyl)ethylamino]benzenecarbothioamide (PubChem CID 106339245) has the molecular formula C10H14BrN3O2S2 and a molecular weight of 352.28 g/mol. Its IUPAC name is 4-bromo-2-[2-(methylsulfamoyl)ethylamino]benzenecarbothioamide.
| Compound Name | 4-bromo-2-[2-(methylsulfamoyl)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 106339245 |
| Molecular Formula | C10H14BrN3O2S2 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 4-bromo-2-[2-(methylsulfamoyl)ethylamino]benzenecarbothioamide |
| SMILES | CNS(=O)(=O)CCNc1cc(Br)ccc1C(N)=S |
| InChI | InChI=1S/C10H14BrN3O2S2/c1-13-18(15,16)5-4-14-9-6-7(11)2-3-8(9)10(12)17/h2-3,6,13-14H,4-5H2,1H3,(H2,12,17) |
| InChIKey | IGQNEPNHPSZYEJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|