C10H14BrN3O2S2 — CID 107799023
4-bromo-2-(propylsulfamoylamino)benzenecarbothioamide (PubChem CID 107799023) has the molecular formula C10H14BrN3O2S2 and a molecular weight of 352.28 g/mol. Its IUPAC name is 4-bromo-2-(propylsulfamoylamino)benzenecarbothioamide.
| Compound Name | 4-bromo-2-(propylsulfamoylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107799023 |
| Molecular Formula | C10H14BrN3O2S2 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 4-bromo-2-(propylsulfamoylamino)benzenecarbothioamide |
| SMILES | CCCNS(=O)(=O)Nc1cc(Br)ccc1C(N)=S |
| InChI | InChI=1S/C10H14BrN3O2S2/c1-2-5-13-18(15,16)14-9-6-7(11)3-4-8(9)10(12)17/h3-4,6,13-14H,2,5H2,1H3,(H2,12,17) |
| InChIKey | LLYAWYLNNUQQPB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|