C13H10Br2N2O2S2 — CID 107799027
4-bromo-2-[(4-bromophenyl)sulfonylamino]benzenecarbothioamide (PubChem CID 107799027) has the molecular formula C13H10Br2N2O2S2 and a molecular weight of 450.18 g/mol. Its IUPAC name is 4-bromo-2-[(4-bromophenyl)sulfonylamino]benzenecarbothioamide.
| Compound Name | 4-bromo-2-[(4-bromophenyl)sulfonylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107799027 |
| Molecular Formula | C13H10Br2N2O2S2 |
| Molecular Weight | 450.18 g/mol |
| Exact Mass | 447.86 |
| IUPAC Name | 4-bromo-2-[(4-bromophenyl)sulfonylamino]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Br)cc1NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H10Br2N2O2S2/c14-8-1-4-10(5-2-8)21(18,19)17-12-7-9(15)3-6-11(12)13(16)20/h1-7,17H,(H2,16,20) |
| InChIKey | HUQPZMNDQATSKK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.18 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|