C13H10BrClN2O2S2 — CID 107799016
4-bromo-2-[(4-chlorophenyl)sulfonylamino]benzenecarbothioamide (PubChem CID 107799016) has the molecular formula C13H10BrClN2O2S2 and a molecular weight of 405.73 g/mol. Its IUPAC name is 4-bromo-2-[(4-chlorophenyl)sulfonylamino]benzenecarbothioamide.
| Compound Name | 4-bromo-2-[(4-chlorophenyl)sulfonylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107799016 |
| Molecular Formula | C13H10BrClN2O2S2 |
| Molecular Weight | 405.73 g/mol |
| Exact Mass | 403.91 |
| IUPAC Name | 4-bromo-2-[(4-chlorophenyl)sulfonylamino]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Br)cc1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H10BrClN2O2S2/c14-8-1-6-11(13(16)20)12(7-8)17-21(18,19)10-4-2-9(15)3-5-10/h1-7,17H,(H2,16,20) |
| InChIKey | FIDOPPKLXZBIQI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.73 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|