C11H8BrClN2O2S3 — CID 64918102
2-[(5-bromothiophen-2-yl)sulfonylamino]-4-chlorobenzenecarbothioamide (PubChem CID 64918102) has the molecular formula C11H8BrClN2O2S3 and a molecular weight of 411.76 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)sulfonylamino]-4-chlorobenzenecarbothioamide.
| Compound Name | 2-[(5-bromothiophen-2-yl)sulfonylamino]-4-chlorobenzenecarbothioamide |
|---|---|
| PubChem CID | 64918102 |
| Molecular Formula | C11H8BrClN2O2S3 |
| Molecular Weight | 411.76 g/mol |
| Exact Mass | 409.86 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)sulfonylamino]-4-chlorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Cl)cc1NS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H8BrClN2O2S3/c12-9-3-4-10(19-9)20(16,17)15-8-5-6(13)1-2-7(8)11(14)18/h1-5,15H,(H2,14,18) |
| InChIKey | WQBJFUZYRUNOQW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|