C11H6BrCl2NO4S2 — CID 80577224
2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-4-chlorobenzoic acid (PubChem CID 80577224) has the molecular formula C11H6BrCl2NO4S2 and a molecular weight of 431.12 g/mol. Its IUPAC name is 2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-4-chlorobenzoic acid.
| Compound Name | 2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 80577224 |
| Molecular Formula | C11H6BrCl2NO4S2 |
| Molecular Weight | 431.12 g/mol |
| Exact Mass | 428.83 |
| IUPAC Name | 2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-4-chlorobenzoic acid |
| SMILES | O=C(O)c1ccc(Cl)cc1NS(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C11H6BrCl2NO4S2/c12-10-7(14)4-9(20-10)21(18,19)15-8-3-5(13)1-2-6(8)11(16)17/h1-4,15H,(H,16,17) |
| InChIKey | UTIKUJJKXVIEGN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.12 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |