C10H6BrClN2O4S2 — CID 104740611
3-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]pyridine-2-carboxylic acid (PubChem CID 104740611) has the molecular formula C10H6BrClN2O4S2 and a molecular weight of 397.66 g/mol. Its IUPAC name is 3-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]pyridine-2-carboxylic acid.
| Compound Name | 3-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 104740611 |
| Molecular Formula | C10H6BrClN2O4S2 |
| Molecular Weight | 397.66 g/mol |
| Exact Mass | 395.86 |
| IUPAC Name | 3-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ncccc1NS(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C10H6BrClN2O4S2/c11-9-5(12)4-7(19-9)20(17,18)14-6-2-1-3-13-8(6)10(15)16/h1-4,14H,(H,15,16) |
| InChIKey | RQDYNCHMTZYLFE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.66 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |