C13H13BrClNO2S2 — CID 80579944
5-bromo-4-chloro-N-(2-propylphenyl)thiophene-2-sulfonamide (PubChem CID 80579944) has the molecular formula C13H13BrClNO2S2 and a molecular weight of 394.74 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-(2-propylphenyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-(2-propylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80579944 |
| Molecular Formula | C13H13BrClNO2S2 |
| Molecular Weight | 394.74 g/mol |
| Exact Mass | 392.93 |
| IUPAC Name | 5-bromo-4-chloro-N-(2-propylphenyl)thiophene-2-sulfonamide |
| SMILES | CCCc1ccccc1NS(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C13H13BrClNO2S2/c1-2-5-9-6-3-4-7-11(9)16-20(17,18)12-8-10(15)13(14)19-12/h3-4,6-8,16H,2,5H2,1H3 |
| InChIKey | JIAKEYKITYJGAB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.74 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |