C12H8BrClN2O3S2 — CID 80577549
5-bromo-4-chloro-N-[2-(cyanomethoxy)phenyl]thiophene-2-sulfonamide (PubChem CID 80577549) has the molecular formula C12H8BrClN2O3S2 and a molecular weight of 407.70 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-[2-(cyanomethoxy)phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-[2-(cyanomethoxy)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80577549 |
| Molecular Formula | C12H8BrClN2O3S2 |
| Molecular Weight | 407.70 g/mol |
| Exact Mass | 405.88 |
| IUPAC Name | 5-bromo-4-chloro-N-[2-(cyanomethoxy)phenyl]thiophene-2-sulfonamide |
| SMILES | N#CCOc1ccccc1NS(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C12H8BrClN2O3S2/c13-12-8(14)7-11(20-12)21(17,18)16-9-3-1-2-4-10(9)19-6-5-15/h1-4,7,16H,6H2 |
| InChIKey | UQDVTHPIVSTZOQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.70 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |