C12H11N3O3S2 — CID 103414535
N-[2-(cyanomethoxy)phenyl]-2-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 103414535) has the molecular formula C12H11N3O3S2 and a molecular weight of 309.37 g/mol. Its IUPAC name is N-[2-(cyanomethoxy)phenyl]-2-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-[2-(cyanomethoxy)phenyl]-2-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 103414535 |
| Molecular Formula | C12H11N3O3S2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | N-[2-(cyanomethoxy)phenyl]-2-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)Nc2ccccc2OCC#N)s1 |
| InChI | InChI=1S/C12H11N3O3S2/c1-9-14-8-12(19-9)20(16,17)15-10-4-2-3-5-11(10)18-7-6-13/h2-5,8,15H,7H2,1H3 |
| InChIKey | IXMRZTBBBCKLGN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |