C12H9BrFN3O2S2 — CID 114614162
5-[(5-bromo-2-fluorophenyl)sulfamoyl]pyridine-2-carbothioamide (PubChem CID 114614162) has the molecular formula C12H9BrFN3O2S2 and a molecular weight of 390.26 g/mol. Its IUPAC name is 5-[(5-bromo-2-fluorophenyl)sulfamoyl]pyridine-2-carbothioamide.
| Compound Name | 5-[(5-bromo-2-fluorophenyl)sulfamoyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 114614162 |
| Molecular Formula | C12H9BrFN3O2S2 |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 388.93 |
| IUPAC Name | 5-[(5-bromo-2-fluorophenyl)sulfamoyl]pyridine-2-carbothioamide |
| SMILES | NC(=S)c1ccc(S(=O)(=O)Nc2cc(Br)ccc2F)cn1 |
| InChI | InChI=1S/C12H9BrFN3O2S2/c13-7-1-3-9(14)11(5-7)17-21(18,19)8-2-4-10(12(15)20)16-6-8/h1-6,17H,(H2,15,20) |
| InChIKey | WPFRJOQNDBYWCV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|