C10H10N4OS2 — CID 106381516
6-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbothioamide (PubChem CID 106381516) has the molecular formula C10H10N4OS2 and a molecular weight of 266.35 g/mol. Its IUPAC name is 6-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbothioamide.
| Compound Name | 6-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 106381516 |
| Molecular Formula | C10H10N4OS2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 6-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbothioamide |
| SMILES | NC(=S)c1ccc(NCc2csc(=O)[nH]2)nc1 |
| InChI | InChI=1S/C10H10N4OS2/c11-9(16)6-1-2-8(12-3-6)13-4-7-5-17-10(15)14-7/h1-3,5H,4H2,(H2,11,16)(H,12,13)(H,14,15) |
| InChIKey | MSIORPPSNDVFTJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|