C16H14N4S — CID 81426768
6-(quinolin-8-ylmethylamino)pyridine-3-carbothioamide (PubChem CID 81426768) has the molecular formula C16H14N4S and a molecular weight of 294.38 g/mol. Its IUPAC name is 6-(quinolin-8-ylmethylamino)pyridine-3-carbothioamide.
| Compound Name | 6-(quinolin-8-ylmethylamino)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 81426768 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 6-(quinolin-8-ylmethylamino)pyridine-3-carbothioamide |
| SMILES | NC(=S)c1ccc(NCc2cccc3cccnc23)nc1 |
| InChI | InChI=1S/C16H14N4S/c17-16(21)13-6-7-14(20-10-13)19-9-12-4-1-3-11-5-2-8-18-15(11)12/h1-8,10H,9H2,(H2,17,21)(H,19,20) |
| InChIKey | BTNWWCZPSMNZGA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|