C16H16N4 — CID 81426632
4-methyl-2-N-(quinolin-8-ylmethyl)pyridine-2,5-diamine (PubChem CID 81426632) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-methyl-2-N-(quinolin-8-ylmethyl)pyridine-2,5-diamine.
| Compound Name | 4-methyl-2-N-(quinolin-8-ylmethyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 81426632 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 4-methyl-2-N-(quinolin-8-ylmethyl)pyridine-2,5-diamine |
| SMILES | Cc1cc(NCc2cccc3cccnc23)ncc1N |
| InChI | InChI=1S/C16H16N4/c1-11-8-15(20-10-14(11)17)19-9-13-5-2-4-12-6-3-7-18-16(12)13/h2-8,10H,9,17H2,1H3,(H,19,20) |
| InChIKey | UGGQQSKXDZEIKU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |