C16H15N3 — CID 81428850
3-N-(quinolin-8-ylmethyl)benzene-1,3-diamine (PubChem CID 81428850) has the molecular formula C16H15N3 and a molecular weight of 249.32 g/mol. Its IUPAC name is 3-N-(quinolin-8-ylmethyl)benzene-1,3-diamine.
| Compound Name | 3-N-(quinolin-8-ylmethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 81428850 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 3-N-(quinolin-8-ylmethyl)benzene-1,3-diamine |
| SMILES | Nc1cccc(NCc2cccc3cccnc23)c1 |
| InChI | InChI=1S/C16H15N3/c17-14-7-2-8-15(10-14)19-11-13-5-1-4-12-6-3-9-18-16(12)13/h1-10,19H,11,17H2 |
| InChIKey | ACBZYYFYYONZFV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|