C15H12Cl2N4 — CID 102759247
3,5-dichloro-6-N-(quinolin-8-ylmethyl)pyridine-2,6-diamine (PubChem CID 102759247) has the molecular formula C15H12Cl2N4 and a molecular weight of 319.20 g/mol. Its IUPAC name is 3,5-dichloro-6-N-(quinolin-8-ylmethyl)pyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-(quinolin-8-ylmethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102759247 |
| Molecular Formula | C15H12Cl2N4 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 3,5-dichloro-6-N-(quinolin-8-ylmethyl)pyridine-2,6-diamine |
| SMILES | Nc1nc(NCc2cccc3cccnc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2N4/c16-11-7-12(17)15(21-14(11)18)20-8-10-4-1-3-9-5-2-6-19-13(9)10/h1-7H,8H2,(H3,18,20,21) |
| InChIKey | BKKFXIRTKCJQHG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |