C9H8ClN3OS — CID 106383027
4-[[(6-chloro-2-pyridinyl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106383027) has the molecular formula C9H8ClN3OS and a molecular weight of 241.70 g/mol. Its IUPAC name is 4-[[(6-chloro-2-pyridinyl)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(6-chloro-2-pyridinyl)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106383027 |
| Molecular Formula | C9H8ClN3OS |
| Molecular Weight | 241.70 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 4-[[(6-chloro-2-pyridinyl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CNc2cccc(Cl)n2)cs1 |
| InChI | InChI=1S/C9H8ClN3OS/c10-7-2-1-3-8(13-7)11-4-6-5-15-9(14)12-6/h1-3,5H,4H2,(H,11,13)(H,12,14) |
| InChIKey | OQDBKRAACHXTMX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.70 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|