C7H7ClN6 — CID 106194524
6-chloro-N-(2H-tetrazol-5-ylmethyl)pyridin-2-amine (PubChem CID 106194524) has the molecular formula C7H7ClN6 and a molecular weight of 210.63 g/mol. Its IUPAC name is 6-chloro-N-(2H-tetrazol-5-ylmethyl)pyridin-2-amine.
| Compound Name | 6-chloro-N-(2H-tetrazol-5-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106194524 |
| Molecular Formula | C7H7ClN6 |
| Molecular Weight | 210.63 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 6-chloro-N-(2H-tetrazol-5-ylmethyl)pyridin-2-amine |
| SMILES | Clc1cccc(NCc2nn[nH]n2)n1 |
| InChI | InChI=1S/C7H7ClN6/c8-5-2-1-3-6(10-5)9-4-7-11-13-14-12-7/h1-3H,4H2,(H,9,10)(H,11,12,13,14) |
| InChIKey | NQXNYHRJACSVKT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.63 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|